C12H16O6 — CID 143693059
dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate;ethane (PubChem CID 143693059) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate;ethane.
| Compound Name | dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate;ethane |
|---|---|
| PubChem CID | 143693059 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate;ethane |
| SMILES | CC.COC(=O)c1ccc(C(=O)OC)c(O)c1O |
| InChI | InChI=1S/C10H10O6.C2H6/c1-15-9(13)5-3-4-6(10(14)16-2)8(12)7(5)11;1-2/h3-4,11-12H,1-2H3;1-2H3 |
| InChIKey | YVKCHWJTMMDCMD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|