C24H30N2O12 — CID 159716996
2,3-dihydroxy-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide;dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate (PubChem CID 159716996) has the molecular formula C24H30N2O12 and a molecular weight of 538.51 g/mol. Its IUPAC name is 2,3-dihydroxy-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide;dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate.
| Compound Name | 2,3-dihydroxy-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide;dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 159716996 |
| Molecular Formula | C24H30N2O12 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2,3-dihydroxy-1-N,4-N-bis(2-methoxyethyl)benzene-1,4-dicarboxamide;dimethyl 2,3-dihydroxybenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(O)c1O.COCCNC(=O)c1ccc(C(=O)NCCOC)c(O)c1O |
| InChI | InChI=1S/C14H20N2O6.C10H10O6/c1-21-7-5-15-13(19)9-3-4-10(12(18)11(9)17)14(20)16-6-8-22-2;1-15-9(13)5-3-4-6(10(14)16-2)8(12)7(5)11/h3-4,17-18H,5-8H2,1-2H3,(H,15,19)(H,16,20);3-4,11-12H,1-2H3 |
| InChIKey | MZODJGBZQHMZQD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 210.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|