C13H14O4Se — CID 102043584
methyl 5-tert-butyl-3-oxo-2,1-benzoxaselenole-7-carboxylate (PubChem CID 102043584) has the molecular formula C13H14O4Se and a molecular weight of 313.21 g/mol. Its IUPAC name is methyl 5-tert-butyl-3-oxo-2,1-benzoxaselenole-7-carboxylate.
| Compound Name | methyl 5-tert-butyl-3-oxo-2,1-benzoxaselenole-7-carboxylate |
|---|---|
| PubChem CID | 102043584 |
| Molecular Formula | C13H14O4Se |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | methyl 5-tert-butyl-3-oxo-2,1-benzoxaselenole-7-carboxylate |
| SMILES | COC(=O)c1cc(C(C)(C)C)cc2c(=O)o[se]c12 |
| InChI | InChI=1S/C13H14O4Se/c1-13(2,3)7-5-8(11(14)16-4)10-9(6-7)12(15)17-18-10/h5-6H,1-4H3 |
| InChIKey | CLECLABFROMGOG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|