About (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate
(1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate (PubChem CID 153287283) has the molecular formula C13H6I4NO3S-
and a molecular weight of 763.88 g/mol. Its IUPAC name is (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate.
Molecular Properties
| Compound Name | (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate |
| PubChem CID | 153287283 |
| Molecular Formula | C13H6I4NO3S- |
| Molecular Weight | 763.88 g/mol |
| Exact Mass | 763.63 |
| IUPAC Name | (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])c1cc(I)cc(I)c1I)c1cccc(I)c1 |
| InChI | InChI=1S/C13H7I4NO3S/c14-7-2-1-3-9(4-7)22(20,21)18-13(19)10-5-8(15)6-11(16)12(10)17/h1-6H,(H,18,19)/p-1 |
| InChIKey | IUIIMZGESOOIKQ-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 763.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate?
The IUPAC name of (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate (CID 153287283) is (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate.
What is the SMILES notation for (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate?
The canonical SMILES for (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate is O=S(=O)(/N=C(\[O-])c1cc(I)cc(I)c1I)c1cccc(I)c1.
What is the InChIKey of (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate?
The InChIKey is IUIIMZGESOOIKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H7I4NO3S/c14-7-2-1-3-9(4-7)22(20,21)18-13(19)10-5-8(15)6-11(16)12(10)17/h1-6H,(H,18,19)/p-1.
What are the key properties of (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate?
(1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate has a molecular weight of 763.88 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2,3,5-triiodo-N-(3-iodophenyl)sulfonylbenzenecarboximidate is sourced from PubChem (CID 153287283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).