C20H20F3INO3S- — CID 172539606
(1Z)-N-(3-iodophenyl)sulfonyl-2,6-di(propan-2-yl)-4-(trifluoromethyl)benzenecarboximidate (PubChem CID 172539606) has the molecular formula C20H20F3INO3S- and a molecular weight of 538.35 g/mol. Its IUPAC name is (1Z)-N-(3-iodophenyl)sulfonyl-2,6-di(propan-2-yl)-4-(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(3-iodophenyl)sulfonyl-2,6-di(propan-2-yl)-4-(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 172539606 |
| Molecular Formula | C20H20F3INO3S- |
| Molecular Weight | 538.35 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | (1Z)-N-(3-iodophenyl)sulfonyl-2,6-di(propan-2-yl)-4-(trifluoromethyl)benzenecarboximidate |
| SMILES | CC(C)c1cc(C(F)(F)F)cc(C(C)C)c1/C([O-])=N/S(=O)(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C20H21F3INO3S/c1-11(2)16-8-13(20(21,22)23)9-17(12(3)4)18(16)19(26)25-29(27,28)15-7-5-6-14(24)10-15/h5-12H,1-4H3,(H,25,26)/p-1 |
| InChIKey | KZGLXWHFDRYASX-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|