C31H37F3 — CID 101460916
1,3-bis[2,6-di(propan-2-yl)phenyl]-5-(trifluoromethyl)benzene (PubChem CID 101460916) has the molecular formula C31H37F3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 101460916 |
| Molecular Formula | C31H37F3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-(trifluoromethyl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(-c2c(C(C)C)cccc2C(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H37F3/c1-18(2)25-11-9-12-26(19(3)4)29(25)22-15-23(17-24(16-22)31(32,33)34)30-27(20(5)6)13-10-14-28(30)21(7)8/h9-21H,1-8H3 |
| InChIKey | KVHQFQZUOKOOEJ-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |