C27H29F3 — CID 91806032
1,3-bis(4-tert-butylphenyl)-5-(trifluoromethyl)benzene (PubChem CID 91806032) has the molecular formula C27H29F3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1,3-bis(4-tert-butylphenyl)-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-bis(4-tert-butylphenyl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91806032 |
| Molecular Formula | C27H29F3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1,3-bis(4-tert-butylphenyl)-5-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H29F3/c1-25(2,3)22-11-7-18(8-12-22)20-15-21(17-24(16-20)27(28,29)30)19-9-13-23(14-10-19)26(4,5)6/h7-17H,1-6H3 |
| InChIKey | XZONCNPBUCGZPU-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |