C21H19F3N2 — CID 101484200
5-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 101484200) has the molecular formula C21H19F3N2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 5-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 101484200 |
| Molecular Formula | C21H19F3N2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | CC(C)(C)c1ccc(-c2cnc(-c3cccc(C(F)(F)F)c3)nc2)cc1 |
| InChI | InChI=1S/C21H19F3N2/c1-20(2,3)17-9-7-14(8-10-17)16-12-25-19(26-13-16)15-5-4-6-18(11-15)21(22,23)24/h4-13H,1-3H3 |
| InChIKey | HCZOKLNYQOOIFE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |