C38H34F6O — CID 50993914
3,4-bis(4-tert-butylphenyl)-2,5-bis[3-(trifluoromethyl)phenyl]furan (PubChem CID 50993914) has the molecular formula C38H34F6O and a molecular weight of 620.68 g/mol. Its IUPAC name is 3,4-bis(4-tert-butylphenyl)-2,5-bis[3-(trifluoromethyl)phenyl]furan.
| Compound Name | 3,4-bis(4-tert-butylphenyl)-2,5-bis[3-(trifluoromethyl)phenyl]furan |
|---|---|
| PubChem CID | 50993914 |
| Molecular Formula | C38H34F6O |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 3,4-bis(4-tert-butylphenyl)-2,5-bis[3-(trifluoromethyl)phenyl]furan |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3cccc(C(F)(F)F)c3)oc(-c3cccc(C(F)(F)F)c3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H34F6O/c1-35(2,3)27-17-13-23(14-18-27)31-32(24-15-19-28(20-16-24)36(4,5)6)34(26-10-8-12-30(22-26)38(42,43)44)45-33(31)25-9-7-11-29(21-25)37(39,40)41/h7-22H,1-6H3 |
| InChIKey | KBKXWUXTGPSSNH-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |