C28H40N2 — CID 160558757
5-tert-butyl-2-[4-(4-tert-butylphenyl)phenyl]pyrimidine;ethane (PubChem CID 160558757) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 5-tert-butyl-2-[4-(4-tert-butylphenyl)phenyl]pyrimidine;ethane.
| Compound Name | 5-tert-butyl-2-[4-(4-tert-butylphenyl)phenyl]pyrimidine;ethane |
|---|---|
| PubChem CID | 160558757 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 5-tert-butyl-2-[4-(4-tert-butylphenyl)phenyl]pyrimidine;ethane |
| SMILES | CC.CC.CC(C)(C)c1ccc(-c2ccc(-c3ncc(C(C)(C)C)cn3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2.2C2H6/c1-23(2,3)20-13-11-18(12-14-20)17-7-9-19(10-8-17)22-25-15-21(16-26-22)24(4,5)6;2*1-2/h7-16H,1-6H3;2*1-2H3 |
| InChIKey | QZAMHVJMODBPKX-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |