C17H15F6N — CID 20709477
5-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butylpyridine (PubChem CID 20709477) has the molecular formula C17H15F6N and a molecular weight of 347.30 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butylpyridine.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butylpyridine |
|---|---|
| PubChem CID | 20709477 |
| Molecular Formula | C17H15F6N |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butylpyridine |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C17H15F6N/c1-15(2,3)14-5-4-10(9-24-14)11-6-12(16(18,19)20)8-13(7-11)17(21,22)23/h4-9H,1-3H3 |
| InChIKey | YIXCHLAQIPBELM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |