C32H25F6NSi — CID 169294031
[4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]naphthalen-2-yl]-2-pyridinyl]phenyl]-trimethylsilane (PubChem CID 169294031) has the molecular formula C32H25F6NSi and a molecular weight of 565.63 g/mol. Its IUPAC name is [4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]naphthalen-2-yl]-2-pyridinyl]phenyl]-trimethylsilane.
| Compound Name | [4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]naphthalen-2-yl]-2-pyridinyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169294031 |
| Molecular Formula | C32H25F6NSi |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]naphthalen-2-yl]-2-pyridinyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc4c3)cn2)cc1 |
| InChI | InChI=1S/C32H25F6NSi/c1-40(2,3)29-11-8-21(9-12-29)30-13-10-24(19-39-30)22-6-4-20-5-7-23(15-25(20)14-22)26-16-27(31(33,34)35)18-28(17-26)32(36,37)38/h4-19H,1-3H3 |
| InChIKey | YWAKFPQFRLGLSF-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|