C12H5Cl3F3N — CID 134637957
5-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)pyridine (PubChem CID 134637957) has the molecular formula C12H5Cl3F3N and a molecular weight of 326.53 g/mol. Its IUPAC name is 5-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)pyridine.
| Compound Name | 5-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134637957 |
| Molecular Formula | C12H5Cl3F3N |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 324.94 |
| IUPAC Name | 5-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc(Cl)c(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C12H5Cl3F3N/c13-8-3-7(4-9(14)11(8)15)6-1-2-10(19-5-6)12(16,17)18/h1-5H |
| InChIKey | SYXIFXCRMCEPMP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|