C12H4Cl3F4N — CID 134636331
3-fluoro-2-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine (PubChem CID 134636331) has the molecular formula C12H4Cl3F4N and a molecular weight of 344.52 g/mol. Its IUPAC name is 3-fluoro-2-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine.
| Compound Name | 3-fluoro-2-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134636331 |
| Molecular Formula | C12H4Cl3F4N |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 3-fluoro-2-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine |
| SMILES | Fc1ccc(C(F)(F)F)nc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H4Cl3F4N/c13-6-3-5(4-7(14)10(6)15)11-8(16)1-2-9(20-11)12(17,18)19/h1-4H |
| InChIKey | KXQPOBIIVPJUCZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|