C14H7Cl3F3NO2 — CID 134636767
methyl 3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134636767) has the molecular formula C14H7Cl3F3NO2 and a molecular weight of 384.57 g/mol. Its IUPAC name is methyl 3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134636767 |
| Molecular Formula | C14H7Cl3F3NO2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | methyl 3-(3,4,5-trichlorophenyl)-6-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(F)(F)F)ccc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H7Cl3F3NO2/c1-23-13(22)12-7(2-3-10(21-12)14(18,19)20)6-4-8(15)11(17)9(16)5-6/h2-5H,1H3 |
| InChIKey | KARYKBWVMRETQB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|