C13H8Cl3NO2 — CID 133088044
methyl 6-chloro-3-(3,4-dichlorophenyl)pyridine-2-carboxylate (PubChem CID 133088044) has the molecular formula C13H8Cl3NO2 and a molecular weight of 316.57 g/mol. Its IUPAC name is methyl 6-chloro-3-(3,4-dichlorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 6-chloro-3-(3,4-dichlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 133088044 |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | methyl 6-chloro-3-(3,4-dichlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)ccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl3NO2/c1-19-13(18)12-8(3-5-11(16)17-12)7-2-4-9(14)10(15)6-7/h2-6H,1H3 |
| InChIKey | DRMWIBPMNLLKHB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|