C7H4Cl2INO2 — CID 86668299
methyl 4,6-dichloro-3-iodopyridine-2-carboxylate (PubChem CID 86668299) has the molecular formula C7H4Cl2INO2 and a molecular weight of 331.92 g/mol. Its IUPAC name is methyl 4,6-dichloro-3-iodopyridine-2-carboxylate.
| Compound Name | methyl 4,6-dichloro-3-iodopyridine-2-carboxylate |
|---|---|
| PubChem CID | 86668299 |
| Molecular Formula | C7H4Cl2INO2 |
| Molecular Weight | 331.92 g/mol |
| Exact Mass | 330.87 |
| IUPAC Name | methyl 4,6-dichloro-3-iodopyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C7H4Cl2INO2/c1-13-7(12)6-5(10)3(8)2-4(9)11-6/h2H,1H3 |
| InChIKey | IYOPRQYKIVCCQN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|