methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate

C8H5F2I2NO2 — CID 134664181

IUPACmethyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate
SMILESCOC(=O)c1nc(C(F)F)cc(I)c1I
InChIInChI=1S/C8H5F2I2NO2/c1-15-8(14)6-5(12)3(11)2-4(13-6)7(9)10/h2,7H,1H3
InChIKeyOIWYXUDKLNZCEG-UHFFFAOYSA-N
MW438.94 g/mol
LogP3.02
Rot. Bonds2

About methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate

methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate (PubChem CID 134664181) has the molecular formula C8H5F2I2NO2 and a molecular weight of 438.94 g/mol. Its IUPAC name is methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate
PubChem CID134664181
Molecular FormulaC8H5F2I2NO2
Molecular Weight438.94 g/mol
Exact Mass438.84
IUPAC Namemethyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate
SMILESCOC(=O)c1nc(C(F)F)cc(I)c1I
InChIInChI=1S/C8H5F2I2NO2/c1-15-8(14)6-5(12)3(11)2-4(13-6)7(9)10/h2,7H,1H3
InChIKeyOIWYXUDKLNZCEG-UHFFFAOYSA-N
XLogP3.02
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500438.94
LogP ≤ 53.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate?
The IUPAC name of methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate (CID 134664181) is methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate.
What is the SMILES notation for methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate?
The canonical SMILES for methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate is COC(=O)c1nc(C(F)F)cc(I)c1I.
What is the InChIKey of methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate?
The InChIKey is OIWYXUDKLNZCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2I2NO2/c1-15-8(14)6-5(12)3(11)2-4(13-6)7(9)10/h2,7H,1H3.
What are the key properties of methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate?
methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate has a molecular weight of 438.94 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate is sourced from PubChem (CID 134664181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).