C8H5F2I2NO2 — CID 134664181
methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate (PubChem CID 134664181) has the molecular formula C8H5F2I2NO2 and a molecular weight of 438.94 g/mol. Its IUPAC name is methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate.
| Compound Name | methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate |
|---|---|
| PubChem CID | 134664181 |
| Molecular Formula | C8H5F2I2NO2 |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.84 |
| IUPAC Name | methyl 6-(difluoromethyl)-3,4-diiodopyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(F)F)cc(I)c1I |
| InChI | InChI=1S/C8H5F2I2NO2/c1-15-8(14)6-5(12)3(11)2-4(13-6)7(9)10/h2,7H,1H3 |
| InChIKey | OIWYXUDKLNZCEG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|