C7H5F2I2NO — CID 130100522
6-(difluoromethyl)-3,4-diiodo-2-methoxypyridine (PubChem CID 130100522) has the molecular formula C7H5F2I2NO and a molecular weight of 410.93 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,4-diiodo-2-methoxypyridine.
| Compound Name | 6-(difluoromethyl)-3,4-diiodo-2-methoxypyridine |
|---|---|
| PubChem CID | 130100522 |
| Molecular Formula | C7H5F2I2NO |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.84 |
| IUPAC Name | 6-(difluoromethyl)-3,4-diiodo-2-methoxypyridine |
| SMILES | COc1nc(C(F)F)cc(I)c1I |
| InChI | InChI=1S/C7H5F2I2NO/c1-13-7-5(11)3(10)2-4(12-7)6(8)9/h2,6H,1H3 |
| InChIKey | PYEHIAIQOXEWOH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|