C8H8ClF2NO2 — CID 118822488
[4-chloro-6-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol (PubChem CID 118822488) has the molecular formula C8H8ClF2NO2 and a molecular weight of 223.61 g/mol. Its IUPAC name is [4-chloro-6-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol.
| Compound Name | [4-chloro-6-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118822488 |
| Molecular Formula | C8H8ClF2NO2 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | [4-chloro-6-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol |
| SMILES | COc1nc(C(F)F)cc(Cl)c1CO |
| InChI | InChI=1S/C8H8ClF2NO2/c1-14-8-4(3-13)5(9)2-6(12-8)7(10)11/h2,7,13H,3H2,1H3 |
| InChIKey | JJJFROULHJUMTR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |