C9H8F5NO3 — CID 134681962
[6-(difluoromethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol (PubChem CID 134681962) has the molecular formula C9H8F5NO3 and a molecular weight of 273.16 g/mol. Its IUPAC name is [6-(difluoromethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol.
| Compound Name | [6-(difluoromethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134681962 |
| Molecular Formula | C9H8F5NO3 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | [6-(difluoromethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol |
| SMILES | COc1c(CO)cc(C(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H8F5NO3/c1-17-6-4(3-16)2-5(7(10)11)15-8(6)18-9(12,13)14/h2,7,16H,3H2,1H3 |
| InChIKey | RSBRVBNNXQJPEE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |