C12H12F5NO4 — CID 134677365
ethyl 2-[6-(difluoromethyl)-4-methoxy-2-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134677365) has the molecular formula C12H12F5NO4 and a molecular weight of 329.22 g/mol. Its IUPAC name is ethyl 2-[6-(difluoromethyl)-4-methoxy-2-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-(difluoromethyl)-4-methoxy-2-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134677365 |
| Molecular Formula | C12H12F5NO4 |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | ethyl 2-[6-(difluoromethyl)-4-methoxy-2-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(OC)cc(C(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C12H12F5NO4/c1-3-21-9(19)4-6-8(20-2)5-7(10(13)14)18-11(6)22-12(15,16)17/h5,10H,3-4H2,1-2H3 |
| InChIKey | HGHPWYOEFJZALC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |