C12H14F3NO4 — CID 134681865
ethyl 2-[4-methoxy-6-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134681865) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is ethyl 2-[4-methoxy-6-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-methoxy-6-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134681865 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl 2-[4-methoxy-6-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(OC)cc(C)nc1OC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO4/c1-4-19-10(17)6-8-9(18-3)5-7(2)16-11(8)20-12(13,14)15/h5H,4,6H2,1-3H3 |
| InChIKey | AOZOEJUYXIXXGJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |