C9H10F3NO3 — CID 134663125
[3-methoxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]methanol (PubChem CID 134663125) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is [3-methoxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]methanol.
| Compound Name | [3-methoxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134663125 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | [3-methoxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]methanol |
| SMILES | COc1c(CO)cc(OC(F)(F)F)nc1C |
| InChI | InChI=1S/C9H10F3NO3/c1-5-8(15-2)6(4-14)3-7(13-5)16-9(10,11)12/h3,14H,4H2,1-2H3 |
| InChIKey | LGKSOYWAMZVAFC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |