C9H7F3N2O2 — CID 130112096
2-[3-hydroxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]acetonitrile (PubChem CID 130112096) has the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. Its IUPAC name is 2-[3-hydroxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[3-hydroxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130112096 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[3-hydroxy-2-methyl-6-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
| SMILES | Cc1nc(OC(F)(F)F)cc(CC#N)c1O |
| InChI | InChI=1S/C9H7F3N2O2/c1-5-8(15)6(2-3-13)4-7(14-5)16-9(10,11)12/h4,15H,2H2,1H3 |
| InChIKey | XYQJILWDRIPUKJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |