C9H10F3NO3 — CID 126674741
[3-amino-2-methoxy-5-(trifluoromethoxy)phenyl]methanol (PubChem CID 126674741) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is [3-amino-2-methoxy-5-(trifluoromethoxy)phenyl]methanol.
| Compound Name | [3-amino-2-methoxy-5-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 126674741 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | [3-amino-2-methoxy-5-(trifluoromethoxy)phenyl]methanol |
| SMILES | COc1c(N)cc(OC(F)(F)F)cc1CO |
| InChI | InChI=1S/C9H10F3NO3/c1-15-8-5(4-14)2-6(3-7(8)13)16-9(10,11)12/h2-3,14H,4,13H2,1H3 |
| InChIKey | FLTYGDCIXZVWFC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|