C8H8F3NO4 — CID 134665683
4-(hydroxymethyl)-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol (PubChem CID 134665683) has the molecular formula C8H8F3NO4 and a molecular weight of 239.15 g/mol. Its IUPAC name is 4-(hydroxymethyl)-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 4-(hydroxymethyl)-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 134665683 |
| Molecular Formula | C8H8F3NO4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 4-(hydroxymethyl)-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol |
| SMILES | COc1cc(CO)c(O)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F3NO4/c1-15-5-2-4(3-13)6(14)7(12-5)16-8(9,10)11/h2,13-14H,3H2,1H3 |
| InChIKey | YCGOXUZJLOYPDG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |