C7H5ClF3NO3 — CID 118817216
4-chloro-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol (PubChem CID 118817216) has the molecular formula C7H5ClF3NO3 and a molecular weight of 243.57 g/mol. Its IUPAC name is 4-chloro-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 4-chloro-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 118817216 |
| Molecular Formula | C7H5ClF3NO3 |
| Molecular Weight | 243.57 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 4-chloro-6-methoxy-2-(trifluoromethoxy)pyridin-3-ol |
| SMILES | COc1cc(Cl)c(O)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C7H5ClF3NO3/c1-14-4-2-3(8)5(13)6(12-4)15-7(9,10)11/h2,13H,1H3 |
| InChIKey | MNNWBTYHFGSHLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |