C9H11F3N2O3 — CID 134680161
[5-(aminomethyl)-2-methoxy-6-(trifluoromethoxy)-3-pyridinyl]methanol (PubChem CID 134680161) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is [5-(aminomethyl)-2-methoxy-6-(trifluoromethoxy)-3-pyridinyl]methanol.
| Compound Name | [5-(aminomethyl)-2-methoxy-6-(trifluoromethoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 134680161 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | [5-(aminomethyl)-2-methoxy-6-(trifluoromethoxy)-3-pyridinyl]methanol |
| SMILES | COc1nc(OC(F)(F)F)c(CN)cc1CO |
| InChI | InChI=1S/C9H11F3N2O3/c1-16-7-6(4-15)2-5(3-13)8(14-7)17-9(10,11)12/h2,15H,3-4,13H2,1H3 |
| InChIKey | VZGNKDGOYDHVIX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |