C10H9F5N2O3 — CID 134683021
methyl 5-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134683021) has the molecular formula C10H9F5N2O3 and a molecular weight of 300.18 g/mol. Its IUPAC name is methyl 5-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 5-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134683021 |
| Molecular Formula | C10H9F5N2O3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | methyl 5-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(CN)c(OC(F)(F)F)nc1C(F)F |
| InChI | InChI=1S/C10H9F5N2O3/c1-19-9(18)5-2-4(3-16)8(20-10(13,14)15)17-6(5)7(11)12/h2,7H,3,16H2,1H3 |
| InChIKey | OASRJIUIOUJPNV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |