C7H7ClF2N2O — CID 119002852
[2-amino-4-chloro-6-(difluoromethyl)-3-pyridinyl]methanol (PubChem CID 119002852) has the molecular formula C7H7ClF2N2O and a molecular weight of 208.59 g/mol. Its IUPAC name is [2-amino-4-chloro-6-(difluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [2-amino-4-chloro-6-(difluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 119002852 |
| Molecular Formula | C7H7ClF2N2O |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | [2-amino-4-chloro-6-(difluoromethyl)-3-pyridinyl]methanol |
| SMILES | Nc1nc(C(F)F)cc(Cl)c1CO |
| InChI | InChI=1S/C7H7ClF2N2O/c8-4-1-5(6(9)10)12-7(11)3(4)2-13/h1,6,13H,2H2,(H2,11,12) |
| InChIKey | SYBCZKUEAHAHEC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |