C8H9ClF2N2O — CID 130107519
[4-amino-3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]methanol (PubChem CID 130107519) has the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. Its IUPAC name is [4-amino-3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [4-amino-3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130107519 |
| Molecular Formula | C8H9ClF2N2O |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | [4-amino-3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]methanol |
| SMILES | Nc1cc(C(F)F)nc(CO)c1CCl |
| InChI | InChI=1S/C8H9ClF2N2O/c9-2-4-5(12)1-6(8(10)11)13-7(4)3-14/h1,8,14H,2-3H2,(H2,12,13) |
| InChIKey | SSJUWWSHAHSHMC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|