C8H9ClF2N2 — CID 130106396
2-(chloromethyl)-6-(difluoromethyl)-3-methylpyridin-4-amine (PubChem CID 130106396) has the molecular formula C8H9ClF2N2 and a molecular weight of 206.62 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(difluoromethyl)-3-methylpyridin-4-amine.
| Compound Name | 2-(chloromethyl)-6-(difluoromethyl)-3-methylpyridin-4-amine |
|---|---|
| PubChem CID | 130106396 |
| Molecular Formula | C8H9ClF2N2 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-(chloromethyl)-6-(difluoromethyl)-3-methylpyridin-4-amine |
| SMILES | Cc1c(N)cc(C(F)F)nc1CCl |
| InChI | InChI=1S/C8H9ClF2N2/c1-4-5(12)2-6(8(10)11)13-7(4)3-9/h2,8H,3H2,1H3,(H2,12,13) |
| InChIKey | OYKMCWJVOQMXTP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|