C7H9F2N3O — CID 118818065
4-amino-2-(aminomethyl)-6-(difluoromethyl)pyridin-3-ol (PubChem CID 118818065) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-amino-2-(aminomethyl)-6-(difluoromethyl)pyridin-3-ol.
| Compound Name | 4-amino-2-(aminomethyl)-6-(difluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 118818065 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 4-amino-2-(aminomethyl)-6-(difluoromethyl)pyridin-3-ol |
| SMILES | NCc1nc(C(F)F)cc(N)c1O |
| InChI | InChI=1S/C7H9F2N3O/c8-7(9)4-1-3(11)6(13)5(2-10)12-4/h1,7,13H,2,10H2,(H2,11,12) |
| InChIKey | KDRRKUWUJCPJDH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |