C9H9F2N3O — CID 118807286
2-[4-(aminomethyl)-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile (PubChem CID 118807286) has the molecular formula C9H9F2N3O and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(aminomethyl)-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118807286 |
| Molecular Formula | C9H9F2N3O |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-[4-(aminomethyl)-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(C(F)F)cc(CN)c1O |
| InChI | InChI=1S/C9H9F2N3O/c10-9(11)7-3-5(4-13)8(15)6(14-7)1-2-12/h3,9,15H,1,4,13H2 |
| InChIKey | KBGXVXSXUNNLMV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |