C8H5ClF2N2O — CID 118845077
2-[4-chloro-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile (PubChem CID 118845077) has the molecular formula C8H5ClF2N2O and a molecular weight of 218.59 g/mol. Its IUPAC name is 2-[4-chloro-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-chloro-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118845077 |
| Molecular Formula | C8H5ClF2N2O |
| Molecular Weight | 218.59 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 2-[4-chloro-6-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(C(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C8H5ClF2N2O/c9-4-3-6(8(10)11)13-5(1-2-12)7(4)14/h3,8,14H,1H2 |
| InChIKey | GMTZFLMKJCLGDC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |