C9H8F3N3 — CID 118806694
2-[4-(aminomethyl)-6-(difluoromethyl)-3-fluoro-2-pyridinyl]acetonitrile (PubChem CID 118806694) has the molecular formula C9H8F3N3 and a molecular weight of 215.18 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-6-(difluoromethyl)-3-fluoro-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(aminomethyl)-6-(difluoromethyl)-3-fluoro-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118806694 |
| Molecular Formula | C9H8F3N3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-[4-(aminomethyl)-6-(difluoromethyl)-3-fluoro-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(C(F)F)cc(CN)c1F |
| InChI | InChI=1S/C9H8F3N3/c10-8-5(4-14)3-7(9(11)12)15-6(8)1-2-13/h3,9H,1,4,14H2 |
| InChIKey | KRRZRWXMCPEECL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |