C9H7ClF2N2 — CID 130074269
2-[5-chloro-6-(difluoromethyl)-3-methyl-2-pyridinyl]acetonitrile (PubChem CID 130074269) has the molecular formula C9H7ClF2N2 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-[5-chloro-6-(difluoromethyl)-3-methyl-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-chloro-6-(difluoromethyl)-3-methyl-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130074269 |
| Molecular Formula | C9H7ClF2N2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-[5-chloro-6-(difluoromethyl)-3-methyl-2-pyridinyl]acetonitrile |
| SMILES | Cc1cc(Cl)c(C(F)F)nc1CC#N |
| InChI | InChI=1S/C9H7ClF2N2/c1-5-4-6(10)8(9(11)12)14-7(5)2-3-13/h4,9H,2H2,1H3 |
| InChIKey | CQFMWQYRPFNBNS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |