C10H11F2N3 — CID 130088430
2-[3-(aminomethyl)-5-(difluoromethyl)-6-methyl-2-pyridinyl]acetonitrile (PubChem CID 130088430) has the molecular formula C10H11F2N3 and a molecular weight of 211.21 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-5-(difluoromethyl)-6-methyl-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(aminomethyl)-5-(difluoromethyl)-6-methyl-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130088430 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-[3-(aminomethyl)-5-(difluoromethyl)-6-methyl-2-pyridinyl]acetonitrile |
| SMILES | Cc1nc(CC#N)c(CN)cc1C(F)F |
| InChI | InChI=1S/C10H11F2N3/c1-6-8(10(11)12)4-7(5-14)9(15-6)2-3-13/h4,10H,2,5,14H2,1H3 |
| InChIKey | FYNUIWJTNURRHR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |