C9H10F2N4 — CID 134683339
2-[4-amino-6-(aminomethyl)-3-(difluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 134683339) has the molecular formula C9H10F2N4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-[4-amino-6-(aminomethyl)-3-(difluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-amino-6-(aminomethyl)-3-(difluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134683339 |
| Molecular Formula | C9H10F2N4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-[4-amino-6-(aminomethyl)-3-(difluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(CN)cc(N)c1C(F)F |
| InChI | InChI=1S/C9H10F2N4/c10-9(11)8-6(14)3-5(4-13)15-7(8)1-2-12/h3,9H,1,4,13H2,(H2,14,15) |
| InChIKey | XQMBWJGVWBCRSE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |