C8H7F2N3O — CID 130104808
2-[5-amino-4-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile (PubChem CID 130104808) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-[5-amino-4-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-amino-4-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130104808 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-[5-amino-4-(difluoromethyl)-3-hydroxy-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(N)c(C(F)F)c1O |
| InChI | InChI=1S/C8H7F2N3O/c9-8(10)6-4(12)3-13-5(1-2-11)7(6)14/h3,8,14H,1,12H2 |
| InChIKey | TUPXDPZOFFIUKF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |