C8H6F2N4O2 — CID 130106921
2-[4-amino-3-(difluoromethyl)-5-nitro-2-pyridinyl]acetonitrile (PubChem CID 130106921) has the molecular formula C8H6F2N4O2 and a molecular weight of 228.16 g/mol. Its IUPAC name is 2-[4-amino-3-(difluoromethyl)-5-nitro-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-amino-3-(difluoromethyl)-5-nitro-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130106921 |
| Molecular Formula | C8H6F2N4O2 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[4-amino-3-(difluoromethyl)-5-nitro-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc([N+](=O)[O-])c(N)c1C(F)F |
| InChI | InChI=1S/C8H6F2N4O2/c9-8(10)6-4(1-2-11)13-3-5(7(6)12)14(15)16/h3,8H,1H2,(H2,12,13) |
| InChIKey | ZHSCQKGMMIEWOL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|