C8H4F2I2N2 — CID 130100638
2-[3-(difluoromethyl)-4,6-diiodo-2-pyridinyl]acetonitrile (PubChem CID 130100638) has the molecular formula C8H4F2I2N2 and a molecular weight of 419.94 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-4,6-diiodo-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(difluoromethyl)-4,6-diiodo-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130100638 |
| Molecular Formula | C8H4F2I2N2 |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.84 |
| IUPAC Name | 2-[3-(difluoromethyl)-4,6-diiodo-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(I)cc(I)c1C(F)F |
| InChI | InChI=1S/C8H4F2I2N2/c9-8(10)7-4(11)3-6(12)14-5(7)1-2-13/h3,8H,1H2 |
| InChIKey | OUDLMNJFKHXUTI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|