C9H12F2N2O — CID 118847964
[6-(aminomethyl)-5-(difluoromethyl)-2-methyl-3-pyridinyl]methanol (PubChem CID 118847964) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is [6-(aminomethyl)-5-(difluoromethyl)-2-methyl-3-pyridinyl]methanol.
| Compound Name | [6-(aminomethyl)-5-(difluoromethyl)-2-methyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118847964 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | [6-(aminomethyl)-5-(difluoromethyl)-2-methyl-3-pyridinyl]methanol |
| SMILES | Cc1nc(CN)c(C(F)F)cc1CO |
| InChI | InChI=1S/C9H12F2N2O/c1-5-6(4-14)2-7(9(10)11)8(3-12)13-5/h2,9,14H,3-4,12H2,1H3 |
| InChIKey | IHSLOIZHSGDRKL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |