C9H12F2N2O2 — CID 118831446
[6-(aminomethyl)-3-(difluoromethyl)-5-methoxy-2-pyridinyl]methanol (PubChem CID 118831446) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is [6-(aminomethyl)-3-(difluoromethyl)-5-methoxy-2-pyridinyl]methanol.
| Compound Name | [6-(aminomethyl)-3-(difluoromethyl)-5-methoxy-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 118831446 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [6-(aminomethyl)-3-(difluoromethyl)-5-methoxy-2-pyridinyl]methanol |
| SMILES | COc1cc(C(F)F)c(CO)nc1CN |
| InChI | InChI=1S/C9H12F2N2O2/c1-15-8-2-5(9(10)11)7(4-14)13-6(8)3-12/h2,9,14H,3-4,12H2,1H3 |
| InChIKey | OMVLBJSCIKZJOT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |