C9H10F2N2O2 — CID 118836807
6-(aminomethyl)-3-(difluoromethyl)-5-methoxypyridine-2-carbaldehyde (PubChem CID 118836807) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 6-(aminomethyl)-3-(difluoromethyl)-5-methoxypyridine-2-carbaldehyde.
| Compound Name | 6-(aminomethyl)-3-(difluoromethyl)-5-methoxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 118836807 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 6-(aminomethyl)-3-(difluoromethyl)-5-methoxypyridine-2-carbaldehyde |
| SMILES | COc1cc(C(F)F)c(C=O)nc1CN |
| InChI | InChI=1S/C9H10F2N2O2/c1-15-8-2-5(9(10)11)7(4-14)13-6(8)3-12/h2,4,9H,3,12H2,1H3 |
| InChIKey | YJUJNGDPEVCKDH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|