C8H8BrF2NO2 — CID 130068911
[5-bromo-3-(difluoromethyl)-6-methoxy-2-pyridinyl]methanol (PubChem CID 130068911) has the molecular formula C8H8BrF2NO2 and a molecular weight of 268.06 g/mol. Its IUPAC name is [5-bromo-3-(difluoromethyl)-6-methoxy-2-pyridinyl]methanol.
| Compound Name | [5-bromo-3-(difluoromethyl)-6-methoxy-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130068911 |
| Molecular Formula | C8H8BrF2NO2 |
| Molecular Weight | 268.06 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | [5-bromo-3-(difluoromethyl)-6-methoxy-2-pyridinyl]methanol |
| SMILES | COc1nc(CO)c(C(F)F)cc1Br |
| InChI | InChI=1S/C8H8BrF2NO2/c1-14-8-5(9)2-4(7(10)11)6(3-13)12-8/h2,7,13H,3H2,1H3 |
| InChIKey | NQICISVRXIGWSQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.06 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |