C9H8F5NO2 — CID 133099748
[5-(difluoromethyl)-6-methoxy-3-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 133099748) has the molecular formula C9H8F5NO2 and a molecular weight of 257.16 g/mol. Its IUPAC name is [5-(difluoromethyl)-6-methoxy-3-(trifluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [5-(difluoromethyl)-6-methoxy-3-(trifluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 133099748 |
| Molecular Formula | C9H8F5NO2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | [5-(difluoromethyl)-6-methoxy-3-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | COc1nc(CO)c(C(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C9H8F5NO2/c1-17-8-4(7(10)11)2-5(9(12,13)14)6(3-16)15-8/h2,7,16H,3H2,1H3 |
| InChIKey | BSCHSRPIWGLFKF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |