C9H10ClF2NO2 — CID 118809943
[6-(chloromethyl)-5-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol (PubChem CID 118809943) has the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. Its IUPAC name is [6-(chloromethyl)-5-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol.
| Compound Name | [6-(chloromethyl)-5-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118809943 |
| Molecular Formula | C9H10ClF2NO2 |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | [6-(chloromethyl)-5-(difluoromethyl)-2-methoxy-3-pyridinyl]methanol |
| SMILES | COc1nc(CCl)c(C(F)F)cc1CO |
| InChI | InChI=1S/C9H10ClF2NO2/c1-15-9-5(4-14)2-6(8(11)12)7(3-10)13-9/h2,8,14H,3-4H2,1H3 |
| InChIKey | MSNSDUKNWRQCKS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|