C7H5Br2F2NO — CID 119011483
2,3-dibromo-5-(difluoromethyl)-6-methoxypyridine (PubChem CID 119011483) has the molecular formula C7H5Br2F2NO and a molecular weight of 316.93 g/mol. Its IUPAC name is 2,3-dibromo-5-(difluoromethyl)-6-methoxypyridine.
| Compound Name | 2,3-dibromo-5-(difluoromethyl)-6-methoxypyridine |
|---|---|
| PubChem CID | 119011483 |
| Molecular Formula | C7H5Br2F2NO |
| Molecular Weight | 316.93 g/mol |
| Exact Mass | 314.87 |
| IUPAC Name | 2,3-dibromo-5-(difluoromethyl)-6-methoxypyridine |
| SMILES | COc1nc(Br)c(Br)cc1C(F)F |
| InChI | InChI=1S/C7H5Br2F2NO/c1-13-7-3(6(10)11)2-4(8)5(9)12-7/h2,6H,1H3 |
| InChIKey | WLAWGEHPGARHBD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|